|
|
| | 3-(Decyldimethylazaniumyl)propane-1-sulfonate Basic information | | Uses |
| | 3-(Decyldimethylazaniumyl)propane-1-sulfonate Chemical Properties |
| Melting point | 221-224°C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | solid | | color | white | | Water Solubility | water: soluble | | BRN | 3967284 | | Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
CLEANSING | | InChI | 1S/C15H33NO3S/c1-4-5-6-7-8-9-10-11-13-16(2,3)14-12-15-20(17,18)19/h4-15H2,1-3H3 | | InChIKey | WKALLSVICJPZTM-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)([O-])CCC[N+](CCCCCCCCCC)(C)C | | CAS DataBase Reference | 15163-36-7(CAS DataBase Reference) | | EPA Substance Registry System | N-Decyl-N,N-dimethyl-3-ammonio-1-propanesulfonate (15163-36-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 2921420090 | | Storage Class | 11 - Combustible Solids |
| | 3-(Decyldimethylazaniumyl)propane-1-sulfonate Usage And Synthesis |
| Uses | 3-(Decyldimethylazaniumyl)propane-1-sulfonate can be widely used as a surfactant in nanomaterial synthesis for the preparation of metal particles and also for biochemical materials.
| | Chemical Properties | White Solid | | Uses | A zwitterionic detergent. | | Uses | Zwitterionic detergent used for protein solubilization. | | General Description | 3-(Decyldimethylammonio)-propane-sulfonate inner salt, a zwitterionic surfactant, is a sulfobetaine. Sulfobetaines contain a positively charged quaternary ammonium group and a negatively charged sulfonic group. |
| | 3-(Decyldimethylazaniumyl)propane-1-sulfonate Preparation Products And Raw materials |
|