- 2,2‘-Dipyrimidyl
-
- $151.00
-
2026-09-14
- CAS:34671-83-5
- Min. Order: 1g
- Purity: 0.98
- Supply Ability: 10kg
- 2,2'-BIPYRIMIDINE
-
- $1.10
-
2026-08-20
- CAS:34671-83-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 2,2'-Bipyrimidine Basic information |
| Product Name: | 2,2'-Bipyrimidine | | Synonyms: | 2,2''-BIPYRIMIDINE TYPICALLY 97%;2,2''-BIPYRIMIDINYL;2,2'-DIPYRIMIDYL;2,2'-Bipyrimidine,96%;2,2′-Bipyrimidine,2,2′-Dipyrimidyl;2,2'-Bipyrimidine 95%;4,6-Dihydroxy-5-(o-methoxyphenoxy)-2,2’4,6-Dichloro-5-(2-methoxyphenoxy)-2,2&rsquo | | CAS: | 34671-83-5 | | MF: | C8H6N4 | | MW: | 158.16 | | EINECS: | 252-137-2 | | Product Categories: | Pyrimidine series;pyrimidine | | Mol File: | 34671-83-5.mol |  |
| | 2,2'-Bipyrimidine Chemical Properties |
| Melting point | 112-116 °C(lit.) | | Boiling point | 395.4±25.0 °C(Predicted) | | density | 1.239 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | pka | -1.22±0.33(Predicted) | | form | powder to crystal | | color | White to Green to Brown | | BRN | 607396 | | InChI | InChI=1S/C8H6N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1-6H | | InChIKey | HKOAFLAGUQUJQG-UHFFFAOYSA-N | | SMILES | C1(C2=NC=CC=N2)=NC=CC=N1 | | CAS DataBase Reference | 34671-83-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2'-Bipyrimidine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2,2'-Bipyrimidine is used in the preparation of 5-bromo-[2,2']bipyrimidinyl. | | General Description | 2,2′-Bipyrimidine (bpym) is a bridging, Π-delocalized bis chelate ligand that complexes with metal ions to form mononuclear and binuclear complexes. The photoluminescence characteristics of 2,2′-bipyrimidine/lanthanide ion complexes have been studied. |
| | 2,2'-Bipyrimidine Preparation Products And Raw materials |
|