| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ala-Ala-Phe-MCA hydrochloride Basic information |
| | Ala-Ala-Phe-MCA hydrochloride Chemical Properties |
| Boiling point | 831.036±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.286±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.539±0.20(predicted) | | color | Off-White | | InChIKey | FVRLYIFIDKXFHU-UHFFFAOYSA-N | | SMILES | CC(N)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)Nc2ccc3C(C)=CC(=O)Oc3c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Ala-Ala-Phe-MCA hydrochloride Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Ala-Ala-Phe-7-amido-4-methylcoumarin has been used:
- in the preparation of the reaction mixture for enzymatic assays
- to initiate theenzyme reaction in tripeptidyl peptidase-1 (TPP1) enzyme activity assay
- to initiate the assay reaction in lysosomal hydrolases activity assay
| | General Description | Ala-Ala-Phe-7-amido-4-methylcoumarin is a fluorogenic substrate for the proteolytic activity. It is a positively charged substrate molecule. |
| | Ala-Ala-Phe-MCA hydrochloride Preparation Products And Raw materials |
|