| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3,5-Trichlorobenzene-d3 Basic information |
| Product Name: | 1,3,5-Trichlorobenzene-d3 | | Synonyms: | 1,3,5-trichlorobenzene-2,4,6-d3,98atom%d;Benzene-1,3,5-d3,2,4,6-trichloro-;1 3 5-TRICHLOROBENZENE-D3 98 ATOM % D;3>-1,3,5-trichlorobenzene;1,3,5-trichloro-2,4,6-trideuterio-benzene;1,3,5-trichlorobenzene-2,4,6-d3;1,3,5-Trichlorobenzene-d3;1,3,5-Trichlorobenzene-D3 98 Atom % D 1g Bottle | | CAS: | 1198-60-3 | | MF: | C6H3Cl3 | | MW: | 181.44 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes | | Mol File: | 1198-60-3.mol |  |
| | 1,3,5-Trichlorobenzene-d3 Chemical Properties |
| Melting point | 56-60 °C(lit.) | | Boiling point | 208 °C(lit.) | | Fp | 260 °F | | form | crystalline solid | | color | White | | InChI | InChI=1S/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H | | InChIKey | XKEFYDZQGKAQCN-UHFFFAOYSA-N | | SMILES | ClC1C([H])=C(Cl)C([H])=C(Cl)C=1[H] |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-52/53 | | Safety Statements | 26-37/39-61-36 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HS Code | 2845901000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | 1,3,5-Trichlorobenzene-d3 Usage And Synthesis |
| Uses | 1,3,5-Trichlorobenzene-d3 (CAS# 1198-60-3) is a useful isotopically labeled research compound. |
| | 1,3,5-Trichlorobenzene-d3 Preparation Products And Raw materials |
|