| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-Nitro-p-tolyl disulfide CAS:35350-31-3 Purity:technical grade, 70% Package:25G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2-Nitro-p-tolyl disulfide CAS:35350-31-3 Purity:98% Remarks:B37437
|
|
| | 2-NITRO-P-TOLYL DISULFIDE Basic information |
| | 2-NITRO-P-TOLYL DISULFIDE Chemical Properties |
| Melting point | 73.5-74 °C(Solv: methanol (67-56-1)) | | Boiling point | 480.6±45.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | InChI | 1S/C14H12N2O4S2/c1-9-3-5-13(11(7-9)15(17)18)21-22-14-6-4-10(2)8-12(14)16(19)20/h3-8H,1-2H3 | | InChIKey | MBTLEECRJWKPIP-UHFFFAOYSA-N | | SMILES | Cc1ccc(SSc2ccc(C)cc2[N+]([O-])=O)c(c1)[N+]([O-])=O | | EPA Substance Registry System | Disulfide, bis(4-methyl-2-nitrophenyl) (35350-31-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-NITRO-P-TOLYL DISULFIDE Usage And Synthesis |
| | 2-NITRO-P-TOLYL DISULFIDE Preparation Products And Raw materials |
|