- Hydrotalcite
-
- $100.00
-
2026-05-28
- CAS:12304-65-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
- Hydrotalcite
-
-
2025-06-20
- CAS:12304-65-3
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20tons
|
| | Hydrotalcite Basic information |
| Product Name: | Hydrotalcite | | Synonyms: | Altacite;dht4;gavite;Aluminum magnesium hydroxide carbonate hydrate;Hydrotalcite (Mg6(CO3)Al(OH)62(OH)4.4H2O);volknerite;Altacet;Altacide | | CAS: | 12304-65-3 | | MF: | CAlO9(-5) | | MW: | 182.99 | | EINECS: | 234-319-3 | | Product Categories: | API | | Mol File: | 12304-65-3.mol |  |
| | Hydrotalcite Chemical Properties |
| density | 2.0 g/mL at 25 °C(lit.) | | Stability: | Stability | | InChI | InChI=1S/CH2O3.Al.6O/c2-1(3)4;;;;;;;/h(H2,2,3,4);;;;;;;/q;+3;6*-1/p-2 | | InChIKey | VLCKXWFFGTZWIG-UHFFFAOYSA-L | | SMILES | C([O-])([O-])=O.[Al+3]([O-])([O-])([O-])([O-])([O-])[O-] |
| | Hydrotalcite Usage And Synthesis |
| Chemical Properties | solid | | Uses | Fireproofing, heat insulating; preparing effervescent magnesium citrate; clarifying liqs by filtration; in tooth and face powders, in polishing Compounds; manufacture of mineral waters, pigments, paper; filler for rubber. |
| | Hydrotalcite Preparation Products And Raw materials |
|