| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Bromo-4'-n-heptylbiphenyl manufacturers
|
| | 4-Bromo-4'-n-heptylbiphenyl Basic information |
| | 4-Bromo-4'-n-heptylbiphenyl Chemical Properties |
| Melting point | 95 °C | | Boiling point | 406.2±24.0 °C(Predicted) | | density | 1.157 | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C19H23Br/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(20)15-13-18/h8-15H,2-7H2,1H3 | | InChIKey | RJQRJLCQHIMUQO-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CCCCCCC)C=C2)=CC=C(Br)C=C1 | | CAS DataBase Reference | 58573-93-6(CAS DataBase Reference) |
| | 4-Bromo-4'-n-heptylbiphenyl Usage And Synthesis |
| | 4-Bromo-4'-n-heptylbiphenyl Preparation Products And Raw materials |
|