|
|
| | 3,4-Dichloro-6-(trifluoromethyl)toluene Basic information |
| Product Name: | 3,4-Dichloro-6-(trifluoromethyl)toluene | | Synonyms: | 3,4-DICHLORO-6-(TRIFLUOROMETHYL)TOLUENE;3,4-DICHLORO-6-METHYLBENZOTRIFLUORIDE;4,5-Dichloro-2-methyltrifluorotoluene;4,5-DICHLORO-2-METHYLTRIFLUOROTOLUENE,98+%;4,5-Dichloro-2-(trifluoromethyl)toluene;3,4-Dichloro-6-trifluoromethyltoluene (DCTFT);1,2-Dichloro-4-Methyl-5-(trifluoroMethyl)benzene;4,5-Dichloro-2-(trifluoromethyl)toluene, 1,2-Dichloro-4-methyl-5-(trifluoromethyl)benzene | | CAS: | 74483-51-5 | | MF: | C8H5Cl2F3 | | MW: | 229.03 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 74483-51-5.mol |  |
| | 3,4-Dichloro-6-(trifluoromethyl)toluene Chemical Properties |
| Boiling point | 97-100 °C(Press: 23 Torr) | | density | 1.404±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H5Cl2F3/c1-4-2-6(9)7(10)3-5(4)8(11,12)13/h2-3H,1H3 | | InChIKey | OARYHYOOIUIKFZ-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(C(F)(F)F)=C(C)C=C1Cl | | CAS DataBase Reference | 74483-51-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 3,4-Dichloro-6-(trifluoromethyl)toluene Usage And Synthesis |
| Uses | 3,4-Dichloro-6-(trifluoromethyl)toluene can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes. | | Synthesis | 
500 ml of hydrogen fluoride, 600 ml of carbon tetrachloride and 140 g of 3,4-dichlorotoluene are reacted at 110?? to 115?? C. and 18.5 to 19.5 bar pressure. 151 g of a stubstance containing, in addition to 79.1% by weight of 3,4-dichlorotoluene, 20.2% by weight of 2-methyl-4,5-dichloro-benzotrifluoride, are obtained, corresponding to 74% of the theoretical yield, relative to 3,4-dichlorotoluene converted. |
| | 3,4-Dichloro-6-(trifluoromethyl)toluene Preparation Products And Raw materials |
|