| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-Glu(biotinyl-PEG)-OH Basic information |
| Product Name: | Fmoc-Glu(biotinyl-PEG)-OH | | Synonyms: | N-ALPHA-FMOC-N-GAMMA-(N-BIOTINYL-3-(2-(2-(3-AMINOPROPYLOXY)-ETHOXY)-ETHOXY)-PROPYL)-L-GLUTAMINE;(R)-1-(9H-fluoren-9-yl)-3,5,24-trioxo-28-((3aR,4R,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-2,13,16,19-tetraoxa-4,9,23-triazaoctacosane-8-carboxylic acid;FMoc-Gln(biotinyl-PEG)-OH;Fmoc-L-Gln(biotinyl-PEG)-OH;Fmoc-L-Glu(biotinyl-PEG)-OH;Nα-Fmoc-Nδ-(N-biotinyl-3-(2-(2-(3-aminopropyloxy)-ethoxy)-ethoxypropyl)-L-glutamine≥ 97% (HPLC);Fmoc-Glu(biotinyl-PEG)-OH Novabiochem;N-α-Fmoc-N-γ-(N-biotinyl-3-(2-(2-(3-aminopropyloxy)ethoxy)ethoxy)propyl)-L-glutamine | | CAS: | 817169-73-6 | | MF: | C40H55N5O10S | | MW: | 797.96 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Fmoc-Glu(biotinyl-PEG)-OH Chemical Properties |
| Boiling point | 1092.9±65.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-5°C | | pka | 3.74±0.10(Predicted) | | form | powder | | Optical Rotation | [α]/D -13.5±1.0°, c = 1 in DMF | | Major Application | peptide synthesis | | InChIKey | MGOWNVYDCIBVKC-FNHRVDEZSA-N | | SMILES | S1[C@H]([C@H]5NC(=O)N[C@H]5C1)CCCCC(=O)NCCCOCCOCCOCCCNC(=O)CC[C@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(=O)O |
| WGK Germany | 3 | | HS Code | 2934 99 90 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Glu(biotinyl-PEG)-OH Usage And Synthesis |
| Chemical Properties | White to pale yellow powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Glu(biotinyl-PEG)-OH Preparation Products And Raw materials |
|