- 2-BROMO-4'-PHENYLACETOPHENONE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:135-73-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-BROMO-4'-PHENYLACETOPHENONE Basic information |
| | 2-BROMO-4'-PHENYLACETOPHENONE Chemical Properties |
| Melting point | 123-125 °C(lit.) | | Boiling point | 370.0±17.0 °C(Predicted) | | density | 1.3930 (rough estimate) | | refractive index | 1.5130 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | form | Powder | | color | Yellow to beige-brown | | Sensitive | Lachrymatory | | BRN | 513838 | | InChI | 1S/C14H11BrO/c15-10-14(16)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2 | | InChIKey | KGHGZRVXCKCJGX-UHFFFAOYSA-N | | SMILES | BrCC(=O)c1ccc(cc1)-c2ccccc2 | | CAS DataBase Reference | 135-73-9(CAS DataBase Reference) | | EPA Substance Registry System | Ethanone, 1-[1,1'-biphenyl]-4-yl-2-bromo- (135-73-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 8-19 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29147000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-BROMO-4'-PHENYLACETOPHENONE Usage And Synthesis |
| Chemical Properties | YELLOWISH TO BEIGE-BROWN POWDER | | Purification Methods | Crystallise (charcoal) the bromide from EtOH (15mL/g), or ethyl acetate/pet ether (b 90-100o). [Beilstein 7 III 2137.] |
| | 2-BROMO-4'-PHENYLACETOPHENONE Preparation Products And Raw materials |
|