|
|
| | Quetiapine Hydroxy Impurity Basic information |
| Product Name: | Quetiapine Hydroxy Impurity | | Synonyms: | Quetiapine Hydroxy Impurity;Quetiapine Deshydroxyethyl IMpurity;2-(4-Dibenzo[b,f][1,4]thiazepin-11-yl-piperazin-1-yl)-ethanol;Quetiapine IMpurity I (Quetiapine Hydroxy IMpurity);Quetiapine Impurity 2;11-(4-[2-HYDROXYETHYL]PIPERAZIN-1-YL)DIBENZO[B,F][1,4]THIAZEPINE;2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol;4-Dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazineethanol | | CAS: | 329216-67-3 | | MF: | C19H21N3OS | | MW: | 339.45 | | EINECS: | | | Product Categories: | | | Mol File: | 329216-67-3.mol |  |
| | Quetiapine Hydroxy Impurity Chemical Properties |
| Melting point | >50°C (dec.) | | Boiling point | 523.4±60.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.96±0.10(Predicted) | | color | White to Light Yellow | | Major Application | pharmaceutical small molecule | | InChI | 1S/C19H21N3OS/c23-14-13-21-9-11-22(12-10-21)19-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20-19/h1-8,23H,9-14H2 | | InChIKey | OFLMIXVKBNAUIB-UHFFFAOYSA-N | | SMILES | [s]1c2c(nc(c4c1cccc4)N3CCN(CC3)CCO)cccc2 |
| WGK Germany | WGK 1 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Repr. 2 STOT SE 3 |
| | Quetiapine Hydroxy Impurity Usage And Synthesis |
| Uses | 4-Dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazineethanol (Quetiapine EP Impurity I) is an antipsychotic drug. |
| | Quetiapine Hydroxy Impurity Preparation Products And Raw materials |
|