|
|
| | 4,4'-(6-chloropyriMidine-2,4-diyl)diMorpholine Basic information |
| Product Name: | 4,4'-(6-chloropyriMidine-2,4-diyl)diMorpholine | | Synonyms: | 6-Chloro-2,4-bis(4-Morpholinyl)pyriMidine;4-chloro-2,6-diMorpholinopyriMidine;2,4-Bis(morpholin-4-yl)-6-chloropyrimidine;100056;6-Chloro-2,4-di(4-morpholinyl);-(6-Chloropyrimidine-2,4-diyl)dimorpholine;6-Chloro-2,4-di(4-morpholinyl)pyrimidine;2,4-Dimorpholino-6-chloropyrimidine | | CAS: | 10244-24-3 | | MF: | C12H17ClN4O2 | | MW: | 284.74 | | EINECS: | | | Product Categories: | | | Mol File: | 10244-24-3.mol |  |
| | 4,4'-(6-chloropyriMidine-2,4-diyl)diMorpholine Chemical Properties |
| Melting point | 139-142℃ | | Boiling point | 508.7±60.0 °C(Predicted) | | density | 1.327±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 6.10±0.50(Predicted) | | Appearance | White to light yellow Solid | | InChI | 1S/C12H17ClN4O2/c13-10-9-11(16-1-5-18-6-2-16)15-12(14-10)17-3-7-19-8-4-17/h9H,1-8H2 | | InChIKey | KIWUTYCMQNZUPX-UHFFFAOYSA-N | | SMILES | ClC1=CC(N2CCOCC2)=NC(N3CCOCC3)=N1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4,4'-(6-chloropyriMidine-2,4-diyl)diMorpholine Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 2,4-bis(4-morpholinyl)-6-chloropyrimidine from morpholine (12.6 mL, 144 mmol) and 2,4,6-trichloropyrimidine (4.4 g, 24 mmol) was as follows: first, the morpholine was dissolved in a mixture of toluene (22 mL) and water (8.8 mL) as solvent. Subsequently, 2,4,6-trichloropyrimidine was dissolved in toluene (22 mL) and slowly added dropwise to the morpholine solution. The reaction mixture was stirred and heated to 83°C at room temperature and maintained for 3 hours. After completion of the reaction, it was cooled to room temperature and phase separation was carried out. The organic phase was washed with 10 mol/L hydrochloric acid and then dried with anhydrous sodium sulfate. The crude product was purified by silica gel column chromatography, and the eluent was a mixed solvent of petroleum ether and ethyl acetate (1:1, v/v), which ultimately afforded 2,4-bis(4-morpholinyl)-6-chloropyrimidine (6.68 g, 98% yield). | | References | [1] Patent: CN105461714, 2016, A. Location in patent: Paragraph 0244; 0245; 0246
[2] Patent: CN105541792, 2016, A. Location in patent: Paragraph 0226; 0227; 0228
[3] Patent: US2016/264546, 2016, A1. Location in patent: Paragraph 0033
[4] Patent: WO2012/44727, 2012, A2. Location in patent: Page/Page column 62-63
[5] Australian Journal of Chemistry, 2002, vol. 55, # 3, p. 205 - 212 |
| | 4,4'-(6-chloropyriMidine-2,4-diyl)diMorpholine Preparation Products And Raw materials |
|