2-BroMoiMidazo[1,2-b]pyridazine manufacturers
|
| | 2-BroMoiMidazo[1,2-b]pyridazine Basic information |
| Product Name: | 2-BroMoiMidazo[1,2-b]pyridazine | | Synonyms: | 2-BroMoiMidazo[1,2-b]pyridazine;Imidazo[1,2-b]pyridazine, 2-bromo-;2-BroMoiMidazo[1,2-b]pyridazine ISO 9001:2015 REACH;Ponatinib Impurity 57;Ponatinib Impurity 34 | | CAS: | 1363166-47-5 | | MF: | C6H4BrN3 | | MW: | 198.02 | | EINECS: | | | Product Categories: | | | Mol File: | 1363166-47-5.mol | ![2-BroMoiMidazo[1,2-b]pyridazine Structure](CAS/20130318/GIF/CB72596740.gif) |
| | 2-BroMoiMidazo[1,2-b]pyridazine Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C6H4BrN3/c7-5-4-10-6(9-5)2-1-3-8-10/h1-4H | | InChIKey | HTIJVQJTGLWNLZ-UHFFFAOYSA-N | | SMILES | C12=NC(Br)=CN1N=CC=C2 |
| | 2-BroMoiMidazo[1,2-b]pyridazine Usage And Synthesis |
| Uses | 2-BroMoiMidazo[1,2-b]pyridazine is often used as a heterocyclic intermediate in pharmaceutical research and organic synthesis. |
| | 2-BroMoiMidazo[1,2-b]pyridazine Preparation Products And Raw materials |
|