| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride Basic information |
| Product Name: | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride | | Synonyms: | benzyl-N,4-diMethylpiperidin-3-aMine dihydrochloride(dr>98/2);raceMic 1-Benzyl-N,4-diMethylpiperidin-3-aMine dihydrochloride;3-Piperidinamine, N,4-dimethyl-1-(phenylmethyl)- (hydrochloride);N,4-Dimethyl-1-(phenylmethyl)-3-piperidinamine hydrochloride (1:2);Tofacitinib Impurity 171;1-Benzyl-N,4-dimethyl-3-piperidinamine dihydrochloride;1-benzyl-N,4-
dimethylpiperidin-3-amine hydrochloride;1-Benzyl-4-methyl-3-(methylamino)piperidine Dihydrochloride | | CAS: | 1228879-37-5 | | MF: | C14H23ClN2 | | MW: | 254.8 | | EINECS: | 807-478-7 | | Product Categories: | | | Mol File: | 1228879-37-5.mol |  |
| | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H22N2.ClH/c1-12-8-9-16(11-14(12)15-2)10-13-6-4-3-5-7-13;/h3-7,12,14-15H,8-11H2,1-2H3;1H | | InChIKey | FVRZQLQXDPJADE-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)N1CCC(C)C(NC)C1.Cl |
| | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride Usage And Synthesis |
| Uses | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride can be used in the synthesis of tofacitinib intermediates. |
| | 1-Benzyl-4-methyl-3-(methylamino)piperidine dihydrochloride Preparation Products And Raw materials |
|