| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 4-Hydroxy-2-(trifluoromethyl)benzoic acid Basic information |
| | 4-Hydroxy-2-(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 159-161°C | | Boiling point | 322.6±42.0 °C(Predicted) | | density | 1.539±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.60±0.36(Predicted) | | form | crystalline powder | | color | White | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H5F3O3/c9-8(10,11)6-3-4(12)1-2-5(6)7(13)14/h1-3,12H,(H,13,14) | | InChIKey | CSQAVQLFCBRQJM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(O)C=C1C(F)(F)F | | CAS DataBase Reference | 320-32-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-51 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2918199890 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 |
| | 4-Hydroxy-2-(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 4-Hydroxy-2-(trifluoromethyl)benzoic acid is used in pharm industry. |
| | 4-Hydroxy-2-(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|