| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:DEFERASIROX ETHYL ESTER
CAS:201530-79-2
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
Deferasirox Ethyl Ester manufacturers
|
| | Deferasirox Ethyl Ester Basic information |
| Product Name: | Deferasirox Ethyl Ester | | Synonyms: | Deferasirox Ethyl Ester;4-[3,5-Bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoic acid ethyl ester;Deferasirox Impurity 8;ethyl 4-[bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoate;Benzoic acid, 4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]-, ethyl ester;Deferasirox EP Impurity E;Deferasirox EP Impurity E HCl;Ethyl 4-(3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl)benzoate (Deferasirox Impurity) | | CAS: | 201530-79-2 | | MF: | C23H19N3O4 | | MW: | 401.41 | | EINECS: | | | Product Categories: | | | Mol File: | 201530-79-2.mol |  |
| | Deferasirox Ethyl Ester Chemical Properties |
| Melting point | 148-151°C | | Boiling point | 638.4±65.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 8.02±0.35(Predicted) | | form | Solid | | color | White to Light Yellow | | InChI | InChI=1S/C23H19N3O4/c1-2-30-23(29)15-11-13-16(14-12-15)26-22(18-8-4-6-10-20(18)28)24-21(25-26)17-7-3-5-9-19(17)27/h3-14,27-28H,2H2,1H3 | | InChIKey | DBCPWOQZLXYJNM-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=CC=C(N2C(C3=CC=CC=C3O)=NC(C3=CC=CC=C3O)=N2)C=C1 |
| | Deferasirox Ethyl Ester Usage And Synthesis |
| Uses | Deferasirox Ethyl Ester is a derivative of Deferasirox (D228650); an orally active tridentate iron chelator. |
| | Deferasirox Ethyl Ester Preparation Products And Raw materials |
|