- MN-64
-
- $90.00 / 50mg
-
2026-04-14
- CAS:92831-11-3
- Min. Order:
- Purity: 99.50%
- Supply Ability: 10g
|
| | 2-(4-Isopropylpheny)-4H-chroMen-4-one Basic information |
| Product Name: | 2-(4-Isopropylpheny)-4H-chroMen-4-one | | Synonyms: | MN-64;2-(4-Propan-2-ylphenyl)chromen-4-one;2-(4-Isopropylpheny)-4H-chroMen-4-one;2-[4-(1-Methylethyl)phenyl]-4H-1-benzopyran-4-one;MN64; MN 64;2-(4-Isopropyl-phenyl)-chromen-4-one;MN64, >98%;4H-1-Benzopyran-4-one, 2-[4-(1-methylethyl)phenyl]- | | CAS: | 92831-11-3 | | MF: | C18H16O2 | | MW: | 264.32 | | EINECS: | | | Product Categories: | | | Mol File: | 92831-11-3.mol |  |
| | 2-(4-Isopropylpheny)-4H-chroMen-4-one Chemical Properties |
| Melting point | 63-64 °C(Solv: ethanol (64-17-5)) | | Boiling point | 389.8±42.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble20mg/mL, clear | | form | powder | | color | white to beige | | InChI | 1S/C18H16O2/c1-12(2)13-7-9-14(10-8-13)18-11-16(19)15-5-3-4-6-17(15)20-18/h3-12H,1-2H3 | | InChIKey | PYTOHIUBXSJKQH-UHFFFAOYSA-N | | SMILES | O=C1C2=CC=CC=C2OC(C3=CC=C(C(C)C)C=C3)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(4-Isopropylpheny)-4H-chroMen-4-one Usage And Synthesis |
| Uses | 2-[4-(1-Methylethyl)phenyl4H-1-benzopyran-4-one is a potent and selective tankyrase (TNKS) inhibitor affecting cell proliferation with potential treatment for cancers. Flavonoid compound with anti-cancer/ anti-bacterial properties. | | Biological Activity | mn-64 is a type of flavone that act as a potent and selective tankyrase inhibitor (ic50 = 6 and 72 nm for tnks1 and tnks2, respectively). [1]tankytase (tnks) is a member of poly adp ribose polymerases (parps). there are two related homologue, tnks1 and tnks2 that are mostly located in the nuclear pore, cytoplasm, mitotic centrosomes and the golgi apparatus. they involve in cellular functions such as regulation of cell proliferation and promoting telomere elongation in human cells. [1]during an assay for screening flavone tnks inhibitors, mn-64 is discovered for abrogating stf luciferase activity at 200nm and potently inhibiting tnks1 with ic50 of 6nm. it also selectively inhibits tnks1 and tnks2 without affecting any other parps. moreover, mn-64 is prominently more selective than other tnks inhibitors such as xav939. [1] | | Biochem/physiol Actions | MN-64 is a very potent inhibitor of Tankyrase 1 and 2 (IC50 = 6 and 72 nM, respectively). The compound MN-64 blocks Wnt signaling in HEK293 cells containing a Wnt pathway reporter system. | | IC 50 | TNKS1: 6 nM (IC50); TNKS2: 72 nM (IC50); ARTD1: 19.1 μM (IC50); ARTD2: 39.4 μM (IC50) | | references | 1. narwal m, koivunen j, haikarainen t et al. discovery of tankyrase inhibiting flavones with increased potency and isoenzyme selectivity. j med chem. 2013 oct 24;56(20):7880-9. |
| | 2-(4-Isopropylpheny)-4H-chroMen-4-one Preparation Products And Raw materials |
|