- 2-Benzylacrylic acid
-
- $0.00 / 1KG
-
2026-03-03
- CAS:5669-19-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 2-Benzylacrylic acid
-
- $1.00 / 1kg
-
2026-01-30
- CAS:5669-19-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- 2-BenzylAcrylicAcid
-
- $0.00 / 25kg
-
2026-01-04
- CAS:5669-19-2
- Min. Order: 1kg
- Purity: 99.0%min
- Supply Ability: 5MT
|
| | 2-Benzylacrylic acid Basic information |
| Product Name: | 2-Benzylacrylic acid | | Synonyms: | BENZYL ACRYLIC ACID;2-BENZYLACRYLIC ACID;2-PROPENOIC ACID, (PHENYLMETHYL)-;o-benzyl acrylic acid;A-BENZYLACRYLIC ACID;2-Methylene-3-phenylpropanoic Acid;a-Methylenebenzenepropanoic Acid;2-BENZYLACRYLIC ACIDE | | CAS: | 5669-19-2 | | MF: | C10H10O2 | | MW: | 162.19 | | EINECS: | 1308068-626-2 | | Product Categories: | Aliphatics;Aromatics;RACECADOTRIL | | Mol File: | 5669-19-2.mol |  |
| | 2-Benzylacrylic acid Chemical Properties |
| Melting point | 66-68 °C | | Boiling point | 170-174 °C(Press: 20 Torr) | | density | 1.120 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.48±0.11(Predicted) | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C10H10O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6H,1,7H2,(H,11,12) | | InChIKey | RYNDYESLUKWOEE-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)C(=C)C(=O)O | | CAS DataBase Reference | 5669-19-2(CAS DataBase Reference) |
| | 2-Benzylacrylic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Racecodotril intermediate | | Uses | 2-Benzylacrylic acid is an organic acid compound, primarily used as an organic synthesis reagent or pharmaceutical intermediate. It can be used in the preparation of polymeric molecular brush hydrogels, the enkephalinase inhibitor Acetorphan, and nano-pesticide formulations. |
| | 2-Benzylacrylic acid Preparation Products And Raw materials |
|