|
|
| | DL-Thiorphan Basic information |
| | DL-Thiorphan Chemical Properties |
| Melting point | 138-140 °C | | Boiling point | 524.0±50.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | RTECS | MC0596440 | | storage temp. | -15°C | | solubility | ethanol: 50 mg/mL, clear, colorless | | form | White solid | | pka | 3.48±0.10(Predicted) | | color | White to Off-White | | BRN | 4872101 | | InChI | 1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) | | InChIKey | LJJKNPQAGWVLDQ-UHFFFAOYSA-N | | SMILES | OC(=O)CNC(=O)C(CS)Cc1ccccc1 | | CAS DataBase Reference | 76721-89-6 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | DL-Thiorphan Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An Enkephalinase inhibitor | | Uses | The active metabolite | | Uses | Thiorphan is a potent inhibitor of neprilysin, a membrane metallo-endopeptidase that cleaves peptide hormones, such as enkephalins, glucagon, and bradykinin (Ki = 4-140 nM). It is much less effective against neprilysin-2 (IC50 = 22.1 μM), angiotensin-converting enzyme, and endothelin-converting enzyme-1. Thiorphan can be produced in vivo via the metabolism of the prodrug acetorphan. Neprilysin is overexpressed in many forms of cancer and may play a role in protecting against Alzheimer’s disease. | | Uses | DL-Thiorphan has been used to evaluate the activity of NEP-dependent neutral endopeptidase. DL-Thiorphan has also been used for determining NEP enzymatic activity using fluorimetric assays. | | Definition | ChEBI: Thiorphan is a N-acyl-amino acid. | | General Description | A thiol-containing amido-acid that selectively binds to the active site zinc of neprilysin (also known as neutral endopeptidase and NEP) and inhibits its activity (IC50 = 2.1 nM). Inhibits the β-amyloid (Aβ) degrading activity of neprilysin in vivo, but does not affect the secretion of either Aβ peptide or amyloid precursor protein (APP). Also shown to inhibit other neprilysin-related family members, such as mouse NL1 (IC50 = 47 nM) and the neprilysin homolog from Ascaris suum (IC50 = 22 μM). Inhibits the activity of angiotensin-converting enzyme (ACE) (IC50 = 140 nM), but has no effect on the activity of endothelin-converting enzyme (ECE). | | Biochem/physiol Actions | Primary TargetNEP activity |
| | DL-Thiorphan Preparation Products And Raw materials |
|