|
|
| | [4-(Methylsulfonyl)phenyl]hydrazine hydrochloride Basic information |
| | [4-(Methylsulfonyl)phenyl]hydrazine hydrochloride Chemical Properties |
| Melting point | 202 °C | | Boiling point | 418.7±37.0 °C(Predicted) | | density | 1.351±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 3.97±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H10N2O2S/c1-12(10,11)7-4-2-6(9-8)3-5-7/h2-5,9H,8H2,1H3 | | InChIKey | ZHYAENSFCNMJQQ-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(S(C)(=O)=O)C=C1)N | | CAS DataBase Reference | 877-66-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | Hazard Note | Irritant |
| | [4-(Methylsulfonyl)phenyl]hydrazine hydrochloride Usage And Synthesis |
| | [4-(Methylsulfonyl)phenyl]hydrazine hydrochloride Preparation Products And Raw materials |
|