|
|
| | Carbamimidothioic acid Basic information |
| Product Name: | Carbamimidothioic acid | | Synonyms: | 2-[4-[(4-nitrophenyl)methoxy]phenyl]ethyl ester, methanesulfonate (1:1);Carbamimidothioic acid;Carbamimidothioic acid, 2-[4-[(4-nitrophenyl)methoxy]phenyl]ethyl ester | | CAS: | 182004-64-4 | | MF: | C16H17N3O3S | | MW: | 331.39 | | EINECS: | | | Product Categories: | | | Mol File: | 182004-64-4.mol |  |
| | Carbamimidothioic acid Chemical Properties |
| Boiling point | 98.4±23.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >10mg/mL | | pka | 0.37±0.10(Predicted) | | form | powder | | color | off-white to tan | | InChI | 1S/C16H17N3O3S.CH4O3S/c17-16(18)23-10-9-12-3-7-15(8-4-12)22-11-13-1-5-14(6-2-13)19(20)21;1-5(2,3)4/h1-8H,9-11H2,(H3,17,18);1H3,(H,2,3,4) | | InChIKey | WGIKEBHIKKWJLG-UHFFFAOYSA-N | | SMILES | CS(O)(=O)=O.NC(=N)SCCc1ccc(OCc2ccc(cc2)[N+]([O-])=O)cc1 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Carbamimidothioic acid Usage And Synthesis |
| Uses | 2-[4-[(4-Nitrophenyl)methoxy]phenyl]ethyl Ester Carbamimidothioic Acid is an inhibitor of the reversed sodium-calcium exchanger (NCX). NCX is a potential therapeutic target for treatment in heart failure and myocardial ischemia-reperfusion. | | Biochem/physiol Actions | KB-R7943 inhibits the reversed Na(+)/Ca(2+) exchanger, NCX. In cardiomyocytes, Ca2+ is released from intracellular stores during contraction, and sequestered again during relaxation. NCX is the primary mechanism that prevents Ca2+ overload due to influx of calcium across the plasma membrane. |
| | Carbamimidothioic acid Preparation Products And Raw materials |
|