| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(4-Boronophenyl)-2-methylpropanenitrile Basic information |
| Product Name: | 2-(4-Boronophenyl)-2-methylpropanenitrile | | Synonyms: | 4-(2-CYANOPROPAN-2-YL)BENZENEBORONIC ACID;4-(2-CYANOPROPAN-2-YL)PHENYLBORONIC ACID;4-(2-Cyanopropan-2-yl)benzeneboronic acid 98%;[4-(1-cyano-1-methylethyl)phenyl]boronic acid;boronic acid, [4-(1-cyano-1-methylethyl)phenyl]-;[4-(1-cyano-1-methylethyl)phenyl]boronic acid(SALTDATA: FREE);4-(2-Cyano-2-propyl)benzeneboronic acid;Boronic acid,B-[4-(1-cyano-1-methylethyl)phenyl]- | | CAS: | 850568-67-1 | | MF: | C10H12BNO2 | | MW: | 189.02 | | EINECS: | | | Product Categories: | blocks;BoronicAcids;Carboxes | | Mol File: | 850568-67-1.mol |  |
| | 2-(4-Boronophenyl)-2-methylpropanenitrile Chemical Properties |
| Melting point | 146-148 | | Boiling point | 370.0±44.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 8.34±0.16(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water. [9 g/100 mL (20°C)] | | InChI | 1S/C10H12BNO2/c1-10(2,7-12)8-3-5-9(6-4-8)11(13)14/h3-6,13-14H,1-2H3 | | InChIKey | BNXBFDTWYHAEIR-UHFFFAOYSA-N | | SMILES | CC(C)(C#N)c1ccc(cc1)B(O)O |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2931900090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(4-Boronophenyl)-2-methylpropanenitrile Usage And Synthesis |
| Uses | Benzene boronic acid mediated the ortho specific hydroxyalkylation of phenols by aldehydes. The ability of boronic acids to reversibly bind diol functional groups has been utilized for fluorescent detection of saccharides. It can be a effective catalyst for amidation and esterification of carboxylic acids. |
| | 2-(4-Boronophenyl)-2-methylpropanenitrile Preparation Products And Raw materials |
|