1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide manufacturers
- 2-CL-IB-MECA
-
-
2026-08-13
- CAS:163042-96-4
- Min. Order: 1G
- Purity: 98%
- Supply Ability: 2000
- Namodenoson
-
- $72.00
-
2026-05-11
- CAS:163042-96-4
- Purity: 99.40%
- Supply Ability: 10g
|
| | 1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide Basic information |
| Product Name: | 1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide | | Synonyms: | 2-CL-IB-MECA;1-(2-Chloro-6-(((3-iodophenyl)methyl)amino)-(9H)-purin-9-yl)-1-deoxy-N-methyl-beta-D-ribofuranuronamide;Cl-IB-MECA, 2-Chloro-N6-(3-iodobenzyl)-adenosine-5μ-N-methyluronamide;1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-β-D-ribofuranuronamide;1-[2-CHLORO-6-[[(3-IODOPHENYL)METHYL]AMINO]-9H-PURIN-9-YL]-1-DEOXY-N-METHYL-β-D-RIBOFURANURONAMIDE
2-Cl-IB-Meca;b-D-RibofuranuronaMide,1-[2-chloro-6-[[(3-iodophenyl)Methyl]aMino]-9H-purin-9-yl]-1-deoxy-N-Methyl-;CF-102;(2S,3S,4R,5R)-5-(2-Chloro-6-((3-iodobenzyl)aMino)-9H-purin-9-yl)-3,4-dihydroxy-N-Methyltetrahydrofuran-2-carboxaMide | | CAS: | 163042-96-4 | | MF: | C18H18ClIN6O4 | | MW: | 544.73 | | EINECS: | | | Product Categories: | | | Mol File: | 163042-96-4.mol | ![1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide Structure](CAS/GIF/163042-96-4.gif) |
| | 1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide Chemical Properties |
| Melting point | 209 °C | | density | 2.04±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO: >20mg/mL | | form | solid | | pka | 12.68±0.70(Predicted) | | color | white | | InChIKey | IPSYPUKKXMNCNQ-VQSLFQOHNA-N | | SMILES | N1(C=NC2C(NCC3=CC=CC(I)=C3)=NC(Cl)=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](C(=O)NC)O1 |&1:19,20,22,24,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933.99.8290 | | Storage Class | 11 - Combustible Solids |
| | 1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide Usage And Synthesis |
| Uses | 2-Cl-IB-MECA acts as an A3 adenosine receptor-selective nucleoside. | | Biological Activity | High affinity and extremely selective A 3 adenosine receptor agonist (K i = 0.33 nM). Displays 2500- and 1400-fold selectivity over A 1 and A 2A receptors respectively. Exhibits high selectivity over the Na + -independent adenosine transporter. | | storage | Desiccate at +4°C |
| | 1-[2-Chloro-6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-1-deoxy-N-methyl-beta-D-ribofuranuronamide Preparation Products And Raw materials |
|