|
|
| | 8-Hydroxyquinoline sulfate Basic information |
| | 8-Hydroxyquinoline sulfate Chemical Properties |
| Melting point | ~175 °C | | density | 1.3819 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5364 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | crystalline | | color | yellow | | Water Solubility | >=10 g/100 mL at 19 ºC | | Merck | 14,4843 | | BRN | 3760550 | | Major Application | pharmaceutical (small molecule) | | Cosmetics Ingredients Functions | ANTIMICROBIAL CHELATING | | Cosmetic Ingredient Review (CIR) | 8-Hydroxyquinoline sulfate (134-31-6) | | InChI | 1S/2C9H7NO.H2O4S/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;1-5(2,3)4/h2*1-6,11H;(H2,1,2,3,4) | | InChIKey | MRUMAIRJPMUAPZ-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.Oc1cccc2cccnc12.Oc3cccc4cccnc34 | | LogP | 2.42 at 25℃ | | CAS DataBase Reference | 134-31-6(CAS DataBase Reference) | | EPA Substance Registry System | 8-Quinolinol sulfate (134-31-6) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | RIDADR | 2811 | | WGK Germany | 1 | | RTECS | VC8260000 | | F | 3-10 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 8-Hydroxyquinoline sulfate Usage And Synthesis |
| Chemical Properties | Crystalline | | Originator | Chinosol,Chinosolfabrik | | Uses | Pharmaceutic aid
(complexing agent). | | Uses | oxyquinoline sulfate is a disinfectant and a preservative against fungus growth. It is made from phenols. | | Uses | 8-Hydroxyquinoline sulfate is used to control grey mould (Botrytis
cinevea) in vine grafting. It is also used as a soil sterilant against damping
off in seed beds. | | Manufacturing Process | The mixture of 1.4 kg o-nitrophenol, 2.1 kg o-aminophenol, 6 kg glycerine (d = 1.26) and 5 kg sulfuric acid (d = 1.848) was heated at reflux to temperature 130°-140°C. This temperature was kept for 1.5 hours. The obtained oxyquinoline precipitated, the liquid was removed with water-steam distillation. The residue was diluted with water and alkalized with sodium hydroxide and sodium carbonate to the strong alkaline reaction. The repeated distillation with water steam gave the oil, which hardened as the long needles by cooling. MP: 75°-76°C recrystallized from diluted ethanol.
In practice it is usually used as sulfate salt | | Therapeutic Function | Antiseptic | | General Description | Pale yellow to yellow crystalline powder with a slight saffron odor. Burning taste. | | Air & Water Reactions | Water soluble. | | Reactivity Profile | A sulfate acidic salt of an amine that is also a phenol. Materials in this group are generally soluble in water. The resulting solutions contain moderate concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions. | | Fire Hazard | Flash point data for 8-Hydroxyquinoline sulfate are not available, but 8-Hydroxyquinoline sulfate is probably combustible. | | Flammability and Explosibility | Not classified | | Metabolic pathway | Little published information is available. | | Degradation | The salt and free base of 8-hydroxyquinoline sulfate are very stable
but alkali liberates quinolin-8-ol which precipitates heavy metals (PM).
8-Hydroxyquinoline is a chelate ligand of transition metals such as
copper. |
| | 8-Hydroxyquinoline sulfate Preparation Products And Raw materials |
|