|
|
| | N,N,N'-Trimethylethylenediamine Basic information |
| Product Name: | N,N,N'-Trimethylethylenediamine | | Synonyms: | 1,2-Diaminoethane, N,N,N'-trimethyl-;2-(Dimethylamino)-N-methylethylamine;Ethylenediamine, N,N,N'-trimethyl-;N,N,N'-trimethylethane-1,2-diamine hydrochloride;N,N,N'-Trimethylethylenediamine;1,2-Ethanediamine,N1,N1,N2-trimethyl-;N,N,N'-Trimethylethylenediamine (TMEDA);n,n,n’-trimethyl-2-ethanediamine | | CAS: | 142-25-6 | | MF: | C5H14N2 | | MW: | 102.18 | | EINECS: | 205-529-2 | | Product Categories: | Polyamines;Nitrogen Compounds;Organic Building Blocks;API | | Mol File: | 142-25-6.mol |  |
| | N,N,N'-Trimethylethylenediamine Chemical Properties |
| Melting point | -30.89°C (estimate) | | Boiling point | 116-118 °C(lit.) | | density | 0.786 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.419(lit.) | | Fp | 49 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | pka | 10.34±0.10(Predicted) | | color | Clear colorless | | BRN | 505989 | | InChI | InChI=1S/C5H14N2/c1-6-4-5-7(2)3/h6H,4-5H2,1-3H3 | | InChIKey | HVOYZOQVDYHUPF-UHFFFAOYSA-N | | SMILES | C(N(C)C)CNC | | LogP | -0.200 | | CAS DataBase Reference | 142-25-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Ethanediamine, N,N,N'-trimethyl- (142-25-6) |
| Hazard Codes | F,C | | Risk Statements | 11-34-37 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 2733 3/PG 2 | | WGK Germany | 3 | | F | 34 | | TSCA | Yes | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29212900 |
| | N,N,N'-Trimethylethylenediamine Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | N,N,N'-Trimethylethylenediamine is used as a precursor in the synthesis of a novel gemini surfactant viz. N,N-dimethyl-N-{2-[N'-methyl-N'-(3-sulfopropyl)-alkylammonium]ethyl}-1-alkylammonium bromides. It is also used as an amine component for in-situ formation of alpha-amino alkoxides. Further, it is involved in the synthesis of N,N'-dimethyl-N'-(2-hydroxy-aethyl)-aethylendiamin. | | General Description | N,N,N′-Trimethylethylenediamine is synthesized using laser-vaporization supersonic molecular beam. It has been studied using pulsed-field ionization zero electron kinetic energy. | | Synthesis | A green and environment-friendly synthesis method of N, N, N'-Trimethylethylenediamine, which comprises the following steps: adding an aqueous solution of methylamine or dimethylamine into a reaction container, dropwise adding an aqueous solution of N, N-dimethylamino chloroethane hydrochloride into the methylamine when the methylamine is added into the reaction container, dropwise adding an aqueous solution of 2-chloro-N-methylethylamine hydrochloride into the dimethylamine when the dimethylamine is added into the reaction container, and obtaining a reaction solution after the reaction is finished; connecting a reaction container and a methylamine absorption device in series, dripping inorganic alkali solution into a reaction solution, and respectively collecting an organic phase and an alkali water phase; rectifying the organic phase to obtain N, N, N'-Trimethylethylenediamine.
|
| | N,N,N'-Trimethylethylenediamine Preparation Products And Raw materials |
|