| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Amino-2-methylbenzenesulfonic acid Basic information |
| | 5-Amino-2-methylbenzenesulfonic acid Chemical Properties |
| Melting point | 200°C | | Boiling point | 500°C (rough estimate) | | density | 1.3553 (rough estimate) | | refractive index | 1.6100 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Acid (Slightly, Heated, Sonicated), Aqueous Base (Slightly, Sonicated) | | pka | -1.11±0.42(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | Sensitive | Hygroscopic | | InChI | InChI=1S/C7H9NO3S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-4H,8H2,1H3,(H,9,10,11) | | InChIKey | BRKFTWHPLMMNHF-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC(N)=CC=C1C | | Dissociation constant | 0-0 at 23℃ | | CAS DataBase Reference | 118-88-7(CAS DataBase Reference) | | EPA Substance Registry System | 5-Amino-o-toluenesulfonic acid (118-88-7) |
| Risk Statements | 20/21/22-34 | | Safety Statements | 26-36/37/39 | | RIDADR | 2585 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III |
| Provider | Language |
|
ALFA
| English |
| | 5-Amino-2-methylbenzenesulfonic acid Usage And Synthesis |
| Uses | 4-Amino-2-sulfotoluene can be used to treat bacterial infections. |
| | 5-Amino-2-methylbenzenesulfonic acid Preparation Products And Raw materials |
|