| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-(-)-2-Oxo-1,5-imidazolidinedicarboxylic acid 1-benzyl ester Basic information |
| | (S)-(-)-2-Oxo-1,5-imidazolidinedicarboxylic acid 1-benzyl ester Chemical Properties |
| Melting point | 189 °C (dec.)(lit.) | | density | 1.444±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.22±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]24/D 63.0°, c = 2.5 in methanol | | InChI | 1S/C12H12N2O5/c15-10(16)9-6-13-11(17)14(9)12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,17)(H,15,16)/t9-/m0/s1 | | InChIKey | AYSUEIZKNBGWGN-VIFPVBQESA-N | | SMILES | OC(=O)[C@@H]1CNC(=O)N1C(=O)OCc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(-)-2-Oxo-1,5-imidazolidinedicarboxylic acid 1-benzyl ester Usage And Synthesis |
| Uses | Z-protected imidazolidinone for sequential N-alkylation. |
| | (S)-(-)-2-Oxo-1,5-imidazolidinedicarboxylic acid 1-benzyl ester Preparation Products And Raw materials |
|