|
|
| | N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate Basic information |
| Product Name: | N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate | | Synonyms: | ETHANOL, 2,2'-((4-AMINOPHENYL)IMINO)BIS-, SULFATE;JAROCOL BHP;2-amino-4-n-(2-hydroxyethyl)-amino]anisole sulfate;2,2’-((4-aminophenyl)imino)bisethanolsulfatehydrate;2,2’-[(4-aminophenyl)imino]bis-ethanosulfate(1:1)(salt);2,2'-((4-Aminophenyl)imino)bisethanol sulfate (salt);4-Amino-N,N-di(beta-hydroxyethyl)aniline sulfate;Ccris 7702 | | CAS: | 54381-16-7 | | MF: | C10H18N2O6S | | MW: | 294.32 | | EINECS: | 259-134-5 | | Product Categories: | | | Mol File: | 54381-16-7.mol |  |
| | N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate Chemical Properties |
| Melting point | 168-171°C | | Boiling point | 125℃[at 101 325 Pa] | | density | 1.497[at 20℃] | | vapor pressure | 65Pa at 20℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), DMSO (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | 178g/L at 20℃ | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4) | | InChIKey | KMCFMEHSEWDYKG-UHFFFAOYSA-N | | SMILES | N(C1C=CC(N)=CC=1)(CCO)CCO.S(O)(O)(=O)=O | | LogP | -2.8 at 20℃ | | CAS DataBase Reference | 54381-16-7(CAS DataBase Reference) | | EPA Substance Registry System | Ethanol, 2,2'-[(4-aminophenyl)imino]bis-, sulfate (1:1) (salt) (54381-16-7) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | HS Code | 29309090 |
| | N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate Usage And Synthesis |
| Chemical Properties | White crystal powder | | Uses | 2,2''-((4-Aminophenyl)azanediyl)diethanol Sulfate is a useful compound in hair dye. Has cosmetic applications. | | Flammability and Explosibility | Non flammable |
| | N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate Preparation Products And Raw materials |
|