| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Titanium ethylhexoxide Basic information |
| Product Name: | Titanium ethylhexoxide | | Synonyms: | 1-Hexanol,2-ethyl-,titanium(4+)salt;2-ethyl-1-hexanotitanium(4++)salt;titaniumtetra(2-ethylhexoxide);TETRAKIS(2-ETHYLHEXYL)TITANATE;TETRAKIS(2-ETHYLHEXYL) ORTHOTITANATE;TETRA-(2-ETHYLHEXYL)TITANATE;TETRA-(2-ETHYLHEXYL) ORTHOTITANATE;TETRAOCTYLTITANATE | | CAS: | 1070-10-6 | | MF: | C8H18OTi | | MW: | 178.1 | | EINECS: | 213-969-1 | | Product Categories: | Organic-metal salt;metal alkoxide | | Mol File: | 1070-10-6.mol |  |
| | Titanium ethylhexoxide Chemical Properties |
| Melting point | 18-20°C | | Boiling point | 248-249 °C/11 mmHg (lit.) | | density | 0.927 g/mL at 25 °C (lit.) | | vapor pressure | 1hPa at 20℃ | | refractive index | n20/D 1.479(lit.) | | Fp | 160 °F | | form | Liquid | | Specific Gravity | 0.927 | | color | Pale yellow | | Water Solubility | 880-1379mg/L at 25℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 3692023 | | Stability: | Stable. Incompatible with bases, acids, strong oxidizing agents. Combustible. Moisture sensitive - store under nitrogen. | | InChI | 1S/4C8H17O.Ti/c4*1-3-5-6-8(4-2)7-9;/h4*8H,3-7H2,1-2H3;/q4*-1;+4 | | InChIKey | KTXWGMUMDPYXNN-UHFFFAOYSA-N | | SMILES | CCCCC(CC)CO[Ti](OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC | | LogP | 2.9-2.95 at 20-25℃ | | CAS DataBase Reference | 1070-10-6(CAS DataBase Reference) | | EPA Substance Registry System | 1-Hexanol, 2-ethyl-, titanium(4+) salt (1070-10-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG III | | WGK Germany | 2 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Titanium ethylhexoxide Usage And Synthesis |
| Chemical Properties | viscous colourless liquid | | Uses | Esterification catalyst for plasticizer production, transesterification catalyst for higher acrylates, and olefin polymerization catalyst.Titanium(IV) 2-ethylhexyloxide is used to formulate adhesives, sealants, lubricant additives and coatings. Further, it is used as a good catalyst for esterifications and transesterifications reactions. In addition to this, it also improves the hardness of surface or gives better dispersion and adhesion, anticorrosive properties and hydrolytic properties in order to use in surface treatment of glass, metal, fillers and pigments. | | Flammability and Explosibility | Non flammable | | reaction suitability | core: titanium reagent type: catalyst | | Toxics Screening Level | The ITSL for 2-ethyihexyltitanate has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on an annual averaging time. |
| | Titanium ethylhexoxide Preparation Products And Raw materials |
|