|
|
| | 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine Basic information |
| Product Name: | 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine | | Synonyms: | 1,3-Dimethyl-2-(diethylamino)-2-(tert-butylimino)-1,3-diaza-2-phospha(V)cyclohexane;1,3-Dimethyl-2-(diethylamino)-2-(tert-butylimino)hexahydro-1,3,2-diazaphosphorine;2-(tert-Butylimino)-2-(diethylamino)-1,3-dimethylhexahydro-1,3,2-diazaphosphorine;2,6-Dimethyl-1-(tert-butylimino)-N,N-diethyl-1,1-dihydro-2,6-diazaphosphorinane-1-amine;2-tert-Butylimino-2-diethylamino-1,3-dimethylhexahydro-1,3,2-diazaphosphorine;N,N-Diethyl-1,3-dimethyl-2-(tert-butylimino)-1,2,3,4,5,6-hexahydro-2H,2H-1,3,2-diazaphosphorine-2-amine;2-TERT-BUTYLIMINO-2-DIETHYLAMINO-1,3-DI- METHYLPERHYDRODIAZAPHOSPHORINE, 98%;2-T-BU-IMINO-2-DIETHAMINO-1,3,DIME-PER-H YDRO-DIAZAPHOSPHOR. | | CAS: | 98015-45-3 | | MF: | C13H31N4P | | MW: | 274.39 | | EINECS: | | | Product Categories: | | | Mol File: | 98015-45-3.mol |  |
| | 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine Chemical Properties |
| Boiling point | 74 °C0.03 mm Hg(lit.) | | density | 0.948 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.477(lit.) | | Fp | 127 °F | | storage temp. | Room Temperature | | solubility | Acetonitrile (Slightly), Water (Slightly) | | form | Liquid | | color | Colorless | | BRN | 5534901 | | InChI | 1S/C13H31N4P/c1-8-17(9-2)18(14-13(3,4)5)15(6)11-10-12-16(18)7/h8-12H2,1-7H3 | | InChIKey | VSCBATMPTLKTOV-UHFFFAOYSA-N | | SMILES | CCN(CC)P1(=NC(C)(C)C)N(C)CCCN1C |
| Hazard Codes | C,N,F | | Risk Statements | 34-67-65-62-51/53-48/20-11 | | Safety Statements | 26-36/37/39-45-62-61-16 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2 Asp. Tox. 1 Eye Dam. 1 Flam. Liq. 2 Repr. 2 Skin Corr. 1B STOT RE 1 Inhalation STOT SE 3 |
| | 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine Usage And Synthesis |
| Uses | Phosphazene Bases: a Family of Extremely Strong, Non-Ionic, Non-Charged Nitrogen–Bases | | General Description | 2-tert-Butylimino-2-diethylamino-1,3-dimethylperhydro-1,3,2-diazaphosphorine (BEMP) is a phosphazene base. BEMP participates in the mild base catalyzed nucleophilic ring opening of N-sulfonyl aziridines. BEMP supported on polystyrene (PS-BEMP) has been reported as an efficient catalyst for the ring-opening of epoxides with phenols. BEMP is about 2000 times more basic and also much more sterically hindered than DBU (l,8-diazabicyclo[5.4.0]undecene). | | References | 1. Schwesinger, R.; Willaredt, J.; Sclemper, H.; Keller, M.; Schmitt, D.; Fritz, H., Chem. Ber. 1994, 127, 2435. 2. Schwesinger, R., Chimia 1985, 39, 269. 3. Commercially available from Fluka. 4. Xu, W.; Mohan, R.; Morrissey, M. M., Biorg. Med. Chem. Lett. 1998, 8, 1089. 5. McComas, W.; Chen, L.; Kim, K., Tetrahedron Lett. 2000, 41, 3573. 6. Caldarelli, M.; Habermann, J.; Ley, S. V., J. Chem. Soc., Perkin Trans. 1. 1999, 107. |
| | 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine Preparation Products And Raw materials |
|