| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Phosphazene base P1-t-Bu Basic information |
| Product Name: | Phosphazene base P1-t-Bu | | Synonyms: | PHOSPHAZENE BASE P1-T-BU ON POLYSTYRENE;N'''-TERT-BUTYL-N,N,N',N',N'',N''-HEXAMETHYLPHOSPHORIMIDIC TRIAMIDE;N-tert-butyl-N,N,N,N,N,N-hexa-methylphos;tert-Butylimino-tris(dimethylamino)phosphorane, Nμ-tert-Butyl-N,N,Nμ,Nμ,N,N-hexamethylphosphorimidic triamide;Phosphazene base P1-t-Bu purum, >=97.0% (GC);tert-Butylimino-tris(dimethylamino)phosphorane 98%;Phosphazene base P1-t-Bu >=97.0% (GC);Phosphorimidic triamide, N'''-(1,1-dimethylethyl)-N,N,N',N',N'',N''-hexamethyl- | | CAS: | 81675-81-2 | | MF: | C10H27N4P | | MW: | 234.32 | | EINECS: | | | Product Categories: | | | Mol File: | 81675-81-2.mol |  |
| | Phosphazene base P1-t-Bu Chemical Properties |
| Boiling point | 175 °C(lit.) | | density | 0.921 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.463 | | Fp | >230 °F | | form | liquid | | BRN | 4178783 | | InChI | 1S/C10H27N4P/c1-10(2,3)11-15(12(4)5,13(6)7)14(8)9/h1-9H3 || 1S/C10H27N4P/c1-10(2,3)11-15(12(4)5,13(6)7)14(8)9/h1-9H3 | | InChIKey | YRNOSHBJMBLOSL-UHFFFAOYSA-N | | SMILES | CN(C)P(N(C)C)(N(C)C)=NC(C)(C)C || CN(C)P(N(C)C)(N(C)C)=NC(C)(C)C |
| Hazard Codes | C,T | | Risk Statements | 34-46-45 | | Safety Statements | 26-36/37/39-45-53 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | F | 3-10-34 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1B
Eye Dam. 1
Muta. 1B
Skin Corr. 1B |
| | Phosphazene base P1-t-Bu Usage And Synthesis |
| | Phosphazene base P1-t-Bu Preparation Products And Raw materials |
|