|
|
| | 1,3-Dibromo-2,5-difluorobenzene Basic information |
| Product Name: | 1,3-Dibromo-2,5-difluorobenzene | | Synonyms: | 1,3-dibromo-2,5-difluorobenzne;Benzene, 1,3-dibromo-2,5-difluoro-;2,5-difluoro-dibromobenzene;1,3-Dibromo-2,5-difluorobenzene ISO 9001：2015 REACH;1,3-dibromo-2,5-difluorobenzene,1,3-Dibromo-2,5-difluoro-benzene,1,4-dibromo-2,5-difluorobenzene;1,3-Dibromo-2,5-difluorobenzene，98% | | CAS: | 128259-68-7 | | MF: | C6H2Br2F2 | | MW: | 271.88 | | EINECS: | | | Product Categories: | | | Mol File: | 128259-68-7.mol |  |
| | 1,3-Dibromo-2,5-difluorobenzene Chemical Properties |
| Boiling point | 208.8±35.0 °C(Predicted) | | density | 2.087±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | Colourless | | InChI | InChI=1S/C6H2Br2F2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H | | InChIKey | QTZSKHCRRPXONC-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=CC(Br)=C1F |
| | 1,3-Dibromo-2,5-difluorobenzene Usage And Synthesis |
| Uses | 1,3-Dibromo-2,5-difluorobenzene is used in organic synthesis and experiments.
|
| | 1,3-Dibromo-2,5-difluorobenzene Preparation Products And Raw materials |
|