|
|
| | Azido-PEG3-(CH2)3OH Basic information |
| Product Name: | Azido-PEG3-(CH2)3OH | | Synonyms: | Azido-PEG3-(CH2)3OH;N3-PEG3-CH2CH2CH2OH;α-Azido-ω-propanl poly(ethylene glycol);Azido-PEG3-C3-OH;1-Propanol, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-;N3-PEG3-PPG1-OH;3-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]-1-propanol | | CAS: | 1807512-36-2 | | MF: | C9H19N3O4 | | MW: | 233.27 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1807512-36-2.mol |  |
| | Azido-PEG3-(CH2)3OH Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C9H19N3O4/c10-12-11-2-5-15-7-9-16-8-6-14-4-1-3-13/h13H,1-9H2 | | InChIKey | UUSDGPCVMBHTRJ-UHFFFAOYSA-N | | SMILES | C(COCCN=[N+]=[N-])OCCOCCCO |
| | Azido-PEG3-(CH2)3OH Usage And Synthesis |
| Description | Azido-PEG3-(CH2)3OH is a PEG linker with three carbon chain between PEG fragemnt and OH group, The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. | | Uses | Azido-PEG3-C3-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG3-C3-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Azido-PEG3-(CH2)3OH Preparation Products And Raw materials |
|