|
|
| | 1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime Basic information |
| Product Name: | 1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime | | Synonyms: | estradiol-6-(o-carboxymethyl)oxime;BETA-ESTRADIOL-6-ONE 6-(O-CARBOXYMETHYLOXIME);6-KETOESTRADIOL 6-(O-CARBOXYMETHYL)OXIME;oestradiol-6-one 6-(O-carboxymethyloxime);β-Estradiol-6-(O-carboxymethyl)oxime, 6-Ketoestradiol 6-(O-carboxymethyloxime), 1,3,5(10)-Estratriene-3,17β-diol-6-one6-(O-carboxymethyloxime), 3,17β-Dihydroxy-1,3,5(10)-estratriene 6-(O-carboxymethyl)oxime;β-Estradiol-6-one 6-(O-carboxymethyloxime);17BETA-ESTRADIOL-6-[O-CARBOXYMETHYL]OXIME;1,3,5-ESTRATRIENE-3,17BETA-DIOL-6-ONE6-(O-CARBOXYMETHYLOXIME) | | CAS: | 35048-47-6 | | MF: | C20H25NO5 | | MW: | 359.42 | | EINECS: | | | Product Categories: | Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 35048-47-6.mol | ![1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime Structure](CAS/GIF/35048-47-6.gif) |
| | 1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime Chemical Properties |
| Melting point | 195-197 °C (decomp) | | Boiling point | 572.6±60.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | pka | 3.10±0.10(Predicted) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | BRN | 2484202 | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChIKey | AWARIMYXKAIIGO-UYGYUSPXSA-N | | SMILES | C[C@]12CC[C@H]3[C@@H](C\C(=N\OCC(O)=O)c4cc(O)ccc34)[C@@H]1CC[C@@H]2O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime Usage And Synthesis |
| Uses | β-Estradiol-6-one 6-(O-carboxymethyloxime) was shown to exhibit regulatory activities towards the expression of leptin, a protein hormone that coordinate appetite/hunger and metabolism.β-Estradiol-6-one 6-(O-carboxymethyloxime) was shown to control the secretion of leptin via membrane associated estrogen receptor alpha in human placental cells. | | Definition | ChEBI: A derivative of 17beta-estradiol having an O-(carboxymethyl)oxime group at the 6-position. | | General Description | β-Estradiol-6-one 6-(O-carboxymethyloxime) is a derivative of 17β-estradiol. | | IC 50 | Alkyl-Chain |
| | 1,3,5[10]-Estratriene-3,17-diol-6-one 6-[O-carboxymethyl]oxime Preparation Products And Raw materials |
|