| Company Name: |
cjbscvictory Gold |
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
4-methyl-6-phenyl-2H-pyranone manufacturers
|
| | 4-methyl-6-phenyl-2H-pyranone Basic information |
| Product Name: | 4-methyl-6-phenyl-2H-pyranone | | Synonyms: | 4-methyl-6-phenyl-2H-2-pyranone;4-methyl-6-phenyl-2H-pyranone;4-Mthyl-6-phenyl-2H-pyranone;2H-Pyran-2-one, 4-methyl-6-phenyl-;4-Methyl-6-phenyl-2H-pyran-2-one;4-methyl-6-phenyl-2H-pyranone, 10 mM in DMSO | | CAS: | 4467-30-5 | | MF: | C12H10O2 | | MW: | 186.2066 | | EINECS: | | | Product Categories: | | | Mol File: | 4467-30-5.mol |  |
| | 4-methyl-6-phenyl-2H-pyranone Chemical Properties |
| InChI | InChI=1S/C12H10O2/c1-9-7-11(14-12(13)8-9)10-5-3-2-4-6-10/h2-8H,1H3 | | InChIKey | AFUWPRQLOLYFDT-UHFFFAOYSA-N | | SMILES | C1(=O)OC(C2=CC=CC=C2)=CC(C)=C1 |
| | 4-methyl-6-phenyl-2H-pyranone Usage And Synthesis |
| Uses | 4-Methyl-6-phenyl-2H-pyranone can be used for the synthesis of N-hydroxypyridone derivatives, which can protect astrocytes against hydrogen peroxide-induced toxicity via improved mitochondrial functionality[1]. | | References | [1] Singh S, et al. Discovery of a novel series of N-hydroxypyridone derivatives protecting astrocytes against hydrogen peroxide-induced toxicity via improved mitochondrial functionality. Bioorg Med Chem. 2017;25(4):1394-1405. DOI:10.1016/j.bmc.2016.12.052 |
| | 4-methyl-6-phenyl-2H-pyranone Preparation Products And Raw materials |
|