|
|
| | Scutellarein tetramethyl ether Basic information |
| Product Name: | Scutellarein tetramethyl ether | | Synonyms: | METHOXYSALVIGENIN, 5-;5-METHOXYSALVIGENIN;5,6,7,3'-TETRAMETHOXYFLAVONE;4H-1-Benzopyran-4-one, 5,6,7-trimethoxy-2-(4-methoxyphenyl)-;5,6,7-Trimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one;Flavone, 4',5,6,7-tetramethoxy-;Flavone, 5,6,7,4'-tetramethoxy;SCUTELLAREIN TETRAMETHYL ETHER, (REAGENT GRADE) | | CAS: | 1168-42-9 | | MF: | C19H18O6 | | MW: | 342.34 | | EINECS: | | | Product Categories: | Tetra-substituted Flavones | | Mol File: | 1168-42-9.mol |  |
| | Scutellarein tetramethyl ether Chemical Properties |
| Melting point | 142-143°C | | Boiling point | 525.7±50.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Brown | | InChI | 1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3 | | InChIKey | URSUMOWUGDXZHU-UHFFFAOYSA-N | | SMILES | O=C1C2=C(OC)C(OC)=C(OC)C=C2OC(C3=CC=C(OC)C=C3)=C1 | | LogP | 3.260 (est) |
| Safety Statements | 22-24/25 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Scutellarein tetramethyl ether Usage And Synthesis |
| Uses | Scutellarein Tetramethyl Ether can be used to inhibit breast cancer resistance protein (BCRP). | | Definition | ChEBI: A tetramethoxyflavone that is the tetra-O-methyl derivative of scutellarein. |
| | Scutellarein tetramethyl ether Preparation Products And Raw materials |
|