2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate manufacturers
|
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate Basic information |
| Product Name: | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate | | Synonyms: | 2,3,4,6-TETRA-O-ACETYL-B-D-*GLUCOPYRANOS YL ISOTHIOC;2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYRANOSYL ISOTHIOCYANATE [FOR HPLC LABELING];1-Isothiocyanato-1-deoxy-β-D-glucopyranose 2,3,4,6-tetraacetate;Tetra-O-acetyl-β-D-glucopyranosyl isothiocyanate;2 3 4 6-TETRA-O-ACETYL-BETA-D-GLUCOPYRA&;2,3,4,6-TETRA-O-ACETYL-1-DEOXY-BETA-D-GLUCOPYRANOSYL ISOTHIOCYANATE;2,3,4,6-Tetra-O-acetyl-?D-glucopyranosyl isothiocyanate;2,3,4,6-tetra-O-acetyl-B-D-*glucopyranosyl isothi | | CAS: | 14152-97-7 | | MF: | C15H19NO9S | | MW: | 389.38 | | EINECS: | | | Product Categories: | pharmacetical;Amino Group Labeling Reagents for HPLC;Analytical Chemistry;Biochemistry;e.e. Determination (HPLC Labeling Reagents);Enantiomer Excess & Absolute Configuration Determination;Glucose;Glycosides;HPLC Labeling Reagents;O-Substituted Sugars;Sugars;UV Detection (HPLC Labeling Reagents);Carbohydrates | | Mol File: | 14152-97-7.mol |  |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate Chemical Properties |
| Melting point | 114-116 °C(lit.) | | Boiling point | 469.7±45.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 56699 | | InChI | InChI=1/C15H19NO9S/c1-7(17)21-5-11-12(22-8(2)18)13(23-9(3)19)14(24-10(4)20)15(25-11)16-6-26/h11-15H,5H2,1-4H3/t11-,12-,13+,14-,15-/s3 | | InChIKey | WOWNQYXIQWQJRJ-UUAXUISXNA-N | | SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@H]1OC(=O)C)N=C=S |&1:0,5,10,12,18,r| | | CAS DataBase Reference | 14152-97-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-42 | | Safety Statements | 22-26-36-45 | | RIDADR | 2810 | | WGK Germany | 3 | | F | 3-8-21 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Chiral reagent for resolution of amino acid derivatives. | | General Description | 2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl isothiocyanate is a chiral derivatization reagent which reacts mainly with enantiomeric amino acids. |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl isothiocyanate Preparation Products And Raw materials |
|