| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:62948-75-8 Purity:>=98.0% Package:500MG
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:Uric Acid-1,3-15N2 CAS:62948-75-8 Purity:98 atom %?15N Package:100mg;25mg;5mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Uric acid-1,3-15N2 CAS:62948-75-8 Purity:98 atom % 15N Package:500MG Remarks:490997-500MG
|
|
| | URIC ACID (1,3-15N2) Basic information |
| Product Name: | URIC ACID (1,3-15N2) | | Synonyms: | URIC ACID (1,3-15N2);URIC ACID-1,3-15N2, 99 ATOM % 15N;URIC ACID-13-15N2 99%;15N Labeled uric acid;2,6,8-Trihydroxypurine-1,3-15N2;7,9-dihydro-3H-purine-2,6,8-trione;7,9-Dihydro-1H-purine-2,6,8(3H)-trione-1,3-15N2;Uric Acid-[15N2 | | CAS: | 62948-75-8 | | MF: | C5H4N4O3 | | MW: | 170.13 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes;U-Z | | Mol File: | 62948-75-8.mol |  |
| | URIC ACID (1,3-15N2) Chemical Properties |
| Melting point | >300 °C (lit.) | | storage temp. | Room Temperature | | solubility | Aqueous Base (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12)/i8+1,9+1 | | InChIKey | LEHOTFFKMJEONL-IOOOXAEESA-N | | SMILES | [H][15N]1C(=O)[15NH]C(=O)C2=C1NC(=O)N2 | | CAS Number Unlabeled | 69-93-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | URIC ACID (1,3-15N2) Usage And Synthesis |
| Uses | Uric Acid-1,3-15N2 is the labeled analogue of Uric Acid (U829200), a heterocyclcic compound that is created when purine nucleotides are broken down of by the human body. High blood concetration of Uric Acid is known as hyperuricemia and is often associated with a wide range of disorders and medical conditions such as gout, diabetes and metabolic syndrome. Uric acid may be a marker of oxidative stress and may have a potential therapeutic role as an antioxidant. |
| | URIC ACID (1,3-15N2) Preparation Products And Raw materials |
|