| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dimethyl trithiocarbonate Basic information |
| | Dimethyl trithiocarbonate Chemical Properties |
| Melting point | -3 °C (lit.) | | Boiling point | 101-102 °C/12 mmHg (lit.) | | density | 1.254 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.675(lit.) | | Fp | 207 °F | | form | liquid | | InChI | InChI=1S/C3H6S3/c1-5-3(4)6-2/h1-2H3 | | InChIKey | IQWMXKTYXNMSLC-UHFFFAOYSA-N | | SMILES | C(=S)(SC)SC |
| RIDADR | UN 3334 | | WGK Germany | 3 | | RTECS | FG2975000 | | Storage Class | 10 - Combustible liquids | | Toxicity | rat,LDLo,oral,500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 44, 1953. |
| | Dimethyl trithiocarbonate Usage And Synthesis |
| Uses | Dimethyl trithiocarbonate may be used in the following studies:
- Preparation of methyl-β,β′-dicarbonyldithiocarboxylate derivatives.
- Generation of tris(organothiyl)methyl radicals and these radicals were evaluated using EPR spectroscopy.
- Preparation of β-oxodithiocarboxylates.
| | Synthesis Reference(s) | Synthetic Communications, 18, p. 1531, 1988 DOI: 10.1080/00397918808081310 |
| | Dimethyl trithiocarbonate Preparation Products And Raw materials |
|