| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3-Dithiole-2-thione-4,5-dicarboxylic acid dimethyl ester Basic information |
| Product Name: | 1,3-Dithiole-2-thione-4,5-dicarboxylic acid dimethyl ester | | Synonyms: | DIMETHYL 2-THIOXO-1,3-DITHIOLE-4,5-DICARBOXYLATE;DIMETHYL 1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLATE;2-Thioxo-1,3-dithiole-4,5-dicarboxylic acid dimethyl ester;Dimethyl 2-Thioxo-1,3-dithiole-4,5-dicarboxylate
1,3-Dithiole-2-thione-4,5-dicarboxylic Acid Dimethyl Ester;Dimethyl1,3-Dithiole-2-thione-4,5-dicarboxylate>1,3-Dithiole-4,5-dicarboxylic acid, 2-thioxo-, 4,5-dimethyl ester;Dimethyl 1,3-dithiol-2-thione-4,5-dicarboxylate;2-Thioxo-1,3-dithiole-4,5-dicarboxylic acid | | CAS: | 7396-41-0 | | MF: | C7H6O4S3 | | MW: | 250.32 | | EINECS: | | | Product Categories: | Charge Transfer Complexes (Synthetic Intermediates);Charge Transfer Complexes for Organic Metals;Functional Materials;Heterocyclic Building Blocks;Others;S-Containing;Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks | | Mol File: | 7396-41-0.mol |  |
| | 1,3-Dithiole-2-thione-4,5-dicarboxylic acid dimethyl ester Chemical Properties |
| Melting point | 86-90 °C (lit.) | | Boiling point | 362.5±52.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | solubility | almost transparency in hot Methanol | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 1288368 | | InChI | 1S/C7H6O4S3/c1-10-5(8)3-4(6(9)11-2)14-7(12)13-3/h1-2H3 | | InChIKey | UZKKFHMMXWDIPD-UHFFFAOYSA-N | | SMILES | COC(=O)C1=C(SC(=S)S1)C(=O)OC |
| WGK Germany | 3 | | F | 8-10-23 | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | 1,3-Dithiole-2-thione-4,5-dicarboxylic acid dimethyl ester Usage And Synthesis |
| Uses | Dimethyl 2-thioxo-1,3-dithiole-4,5-dicarboxylate is a sulphur-containing heterocyclic building block. It has been reported to be formed during the reaction of 1,3-dithiolan-2-thiones with dimethyl acetylenedicarboxylate. It is formed as major product during the reaction of ethylene trithiocarbonate with dimethyl acetylenedicarboxylate. | | Definition | ChEBI: 2-sulfanylidene-1,3-dithiole-4,5-dicarboxylic acid dimethyl ester is a heteroarene. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 47, p. 4000, 1982 DOI: 10.1021/jo00141a044 | | General Description | Dimethyl 2-thioxo-1,3-dithiole-4,5-dicarboxylate is a sulphur-containing heterocyclic building block. It has been reported to be formed during the reaction of 1,3-dithiolan-2-thiones with dimethyl acetylenedicarboxylate. It is formed as major product during the reaction of ethylene trithiocarbonate with dimethyl acetylenedicarboxylate. |
| | 1,3-Dithiole-2-thione-4,5-dicarboxylic acid dimethyl ester Preparation Products And Raw materials |
|