|
|
| | D-Glucosamine 6-phosphate Basic information |
| | D-Glucosamine 6-phosphate Chemical Properties |
| Melting point | >127°C (dec.) | | Boiling point | 652.2±65.0 °C(Predicted) | | density | 1.749±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Water (Slightly) | | pka | pKa 6.10 /8.14(H2O,t = 26.3,c=0.01,N2)(Approximate) | | form | Solid | | color | White to Off-White | | biological source | natural (inorganic) | | Water Solubility | water: 50mg/mL, clear to hazy, colorless to almost colorless | | Stability: | Hygroscopic | | InChI | 1S/C6H14NO8P/c7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,9-11H,2,7H2,(H2,12,13,14) | | InChIKey | AEJSSXDYDSUOOZ-UHFFFAOYSA-N | | SMILES | NC(C=O)C(O)C(O)C(O)COP(O)(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Glucosamine 6-phosphate Usage And Synthesis |
| Uses | D-Glucosamine 6-phosphate is an endogenous metabolite that can be synthesized by glutamine fructose-6-phosphate amidotransferase (GFAT). D-Glucosamine 6-phosphate can be used for the research of diabetes mellitus[1]. | | Definition | ChEBI: The pyranose form of D-glucosamine 6-phosphate. | | General Description | D-Glucosamine 6-phosphate, the natural form of glucosamine, is a monosaccharide produced during hexosamine biosynthesis pathway by the enzyme glucosamine-6-phosphate deaminase from the two substrates fructose 6-phosphate and glutamine. | | References | [1] Wu G, et al. Presence of glutamine:fructose-6-phosphate amidotransferase for glucosamine-6-phosphate synthesis in endothelial cells: effects of hyperglycaemia and glutamine. Diabetologia. 2001 Feb;44(2):196-202. DOI:10.1007/s001250051599 |
| | D-Glucosamine 6-phosphate Preparation Products And Raw materials |
|