|
|
| Product Name: | Ethylmethyl-carbamic chloride | | Synonyms: | N,N-ETHYLMETHYL CARBAMOYL CHLORIDE;N-ETHYL-N-METHYLCARBAMONYL CHLORIDE;CarbaMic chloride,N-ethyl-N-Methyl-;Rivastigmine Intermediate 1;Ethylmethyl-carbamic chloride;CARBAMIC CHLORIDE, ETHYLMETHYL-;ETHYLMETHYLCARBAMOYL CHLORIDE;cis-2-(2-benzylcarboxylamido-4-thiazolyl)-4-(3-methyl-2-butyleneoxycarboxyl)-2-butenoicacid | | CAS: | 42252-34-6 | | MF: | C4H8ClNO | | MW: | 121.57 | | EINECS: | 610-003-4 | | Product Categories: | Miscellaneous Reagents | | Mol File: | 42252-34-6.mol |  |
| | Ethylmethyl-carbamic chloride Chemical Properties |
| Boiling point | 89°C/40mmHg(lit.) | | density | 1.101±0.06 g/cm3(Predicted) | | refractive index | 1.4500-1.4540 | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | clear liquid | | pka | -1.85±0.70(Predicted) | | color | Colorless to Almost colorless | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H8ClNO/c1-3-6(2)4(5)7/h3H2,1-2H3 | | InChIKey | XZVYDRLPXWFRIS-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)N(CC)C | | CAS DataBase Reference | 42252-34-6(CAS DataBase Reference) |
| RIDADR | 3265 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2924190015 |
| | Ethylmethyl-carbamic chloride Usage And Synthesis |
| Uses | N-Ethyl-N-methylcarbamoyl chloride is used as an intermediate for rivastigmine. | | Application | N-Ethyl-N-methylcarbamoyl chloride is a compound that can be used in organic synthesis. | | Chemical Properties | Pale Yellow Oil | | Synthesis | Example 1: A solution of N-ethylmethylamine (100 g, 1.69 mol) in dichloromethane (1.5 L) was slowly added dropwise to a suspension in dichloromethane (2 L) containing sodium bicarbonate (284 g, 3.384 mol) and triphosgene (332 g, 1.117 mol), the temperature was maintained at a controlled level of 10-15°C, and the dropwise process lasted for 2 hours. After completion of the dropwise addition, the reaction mixture was continued to be stirred at room temperature for 3 hours. Upon completion of the reaction, the resulting sodium chloride was removed by filtration and the filtrate was concentrated under reduced pressure to afford 189 g of N-methyl-N-ethylcarbamoyl chloride, the product being a light yellow oil (yield: 92%). Example 3: The procedure of Example 2 was repeated, only the solvent was changed to methylene chloride, and the rest of the reaction conditions remained unchanged. The experimental results are shown in Table 2, the yield consistently exceeded 98%. | | References | [1] Patent: WO2007/80430, 2007, A1. Location in patent: Page/Page column 12; 13 [2] Research on Chemical Intermediates, 2014, vol. 40, # 2, p. 787 - 800 [3] Patent: WO2013/150529, 2013, A2. Location in patent: Page/Page column 24; 25; 28; 29 [4] Patent: WO2007/80430, 2007, A1. Location in patent: Page/Page column 13 |
| | Ethylmethyl-carbamic chloride Preparation Products And Raw materials |
|