|
|
| | FMOC-ARG(ME,PBF)-OH Basic information |
| Product Name: | FMOC-ARG(ME,PBF)-OH | | Synonyms: | N-ALPHA-FMOC-N-OMEGA-METHYL-N-OMEGA'-(2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE;FMOC-ARG(ME,PBF)-OH;N-α-(9-Fluorenylmethoxycarbonyl)-N-ω-methyl-N-ω'-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-arginine;Fmoc-Arg(Me,Pbf);Nα-Fmoc-Nω-methyl-Nω'-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-arginine≥ 98% (HPLC);(9H-Fluoren-9-yl)MethOxy]Carbonyl Arg(Me,Pbf)-OH;FMoc-Arg(Pbf,Me)-OH;(S,Z)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-5-(3-Methyl-2-((2,2,4,6,7-pentaMethyl-2,3-dihydrobenzofuran-5-yl)sulfonyl)guanidino)pentanoic acid | | CAS: | 1135616-49-7 | | MF: | C35H42N4O7S | | MW: | 662.8 | | EINECS: | | | Product Categories: | Fmoc Amino Acids - Arg;amino acids | | Mol File: | Mol File |  |
| | FMOC-ARG(ME,PBF)-OH Chemical Properties |
| density | 1.33 | | storage temp. | Store at -15°C to -25°C. | | pka | 3.80±0.21(Predicted) | | form | powder | | Appearance | Off-white to light yellow Solid | | Major Application | peptide synthesis | | InChIKey | JAUPJPAADXVUGQ-LJAQVGFWSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(NS(C1=C(C)C(C)=C2OC(C)(C)CC2=C1C)(=O)=O)=NC)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | FMOC-ARG(ME,PBF)-OH Usage And Synthesis |
| Description | FMOC-Arg (ME, PBF)-OH is a kind of protected form of arginine. Arginine is double-protected by butyloxycarbonyl (BOC) and 2, 2, 4, 6, 7-pentamethyldihydrobenzofuran-5-sulfonyl (PBF). It is a derivative for introducing mono-methyl-arginine during Fmoc SPPS. Coupling can be carried out using any standard activation method. PBF protecting group can be removed by TFA-mediated cleavage reaction. As a kind of protected amino acid, it is an important intermediate in various fields such as peptide synthesis, asymmetric synthesis, medicinal chemistry as well as polymer chemistry. | | Chemical Properties | White powder | | Uses | Fmoc-Arg(Me,pbf)-OH can be used as reactant/reagent in design, synthesis and structure-activity relationship of macrocyclic peptidomimetics that bind to WDR5 and block WDR5-MLL protein-protein interaction. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | References | https://www.merckmillipore.com/CN/zh/product/Fmoc-Arg%28Me%2CPbf%29-OH,MDA_CHEM-852105ReferrerURL=https%3A%2F%2Fguge6.firstguo.com%2F&bd=1
https://en.wikipedia.org/wiki/Peptide_synthesis
Kim, Tae-il, et al. "Arginine-conjugated polypropylenimine dendrimer as a non-toxic and efficient gene delivery carrier." Biomaterials 28.11 (2007): 2061-2067. |
| | FMOC-ARG(ME,PBF)-OH Preparation Products And Raw materials |
|