|
|
| | Diethyl amino methyl triethoxy silane Basic information | | Introduction |
| | Diethyl amino methyl triethoxy silane Chemical Properties |
| Boiling point | 110-130°C (5 mmHg) | | density | 0,933 g/cm3 | | refractive index | 1.4142 | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.91±0.25(Predicted) | | Specific Gravity | 0.9336 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C11H27NO3Si/c1-6-12(7-2)11-16(13-8-3,14-9-4)15-10-5/h6-11H2,1-5H3 | | InChIKey | UMXXGDJOCQSQBV-UHFFFAOYSA-N | | SMILES | C(N(CC)C[Si](OCC)(OCC)OCC)C | | CAS DataBase Reference | 15180-47-9(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN3267 | | TSCA | No | | HazardClass | 8 | | HS Code | 29319090 | | Toxicity | mammal (species unspecified),LD50,unreported,12500mg/kg (12500mg/kg),Pharmaceutical Chemistry Journal Vol. 9, Pg. 165, 1975. |
| | Diethyl amino methyl triethoxy silane Usage And Synthesis |
| Introduction | Diethyl amino methyl triethoxy silane is a novel alfa silane. The close proximity of the nitrogen atom to the silicon atom can accelerate hydrolysis reaction compared to (amino-propyl)silanes.
Applications:
- Diethyl amino methyl triethoxy silane can be used as crosslinking agent for RTV silicone rubber;
- Used as anchoring agent of synthetic resin;
- Used as raw material of finishing agent to manufacture fabrics.
| | Chemical Properties | Yellowish clear liquid | | Uses | N-Ethyl-N-[(triethoxysilyl)methyl]ethanamine is used in the high-throughput identification of dominant negative polypeptides in yeast. |
| | Diethyl amino methyl triethoxy silane Preparation Products And Raw materials |
|