| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 8-AHA-CAMP Basic information |
| Product Name: | 8-AHA-CAMP | | Synonyms: | 8-(6-aminohexyl)aminoadenosine*3’:5’-cyclicmonop;8-(6-aminohexylamino)adenosine-3’,5’-cyclicmonophosphate(8-aha-camp);8-(6-AMINOHEXYL) AMINOADENOSINE-3',5'-CYCLIC MONOPHOSPHATE;8-(6-AMINOHEXYL)AMINO-ADENOSINE 3':5'-CYCLIC MONOPHOSPHATE;8-AHA-CAMP;8-(6-AMINOHEXYL)AMINOADENOSINE3':5'-CYCL IC MONOPHO;8-(6-Aminohexyl)-aminoadenosine-3'',5''-cyclic monophosphoric acid sodium sal;8-aminohexylaminocamp | | CAS: | 39824-30-1 | | MF: | C16H26N7O6P | | MW: | 443.4 | | EINECS: | | | Product Categories: | Enzyme Inhibitors;Enzyme Inhibitors by Type;Substrate Analogs | | Mol File: | 39824-30-1.mol |  |
| | 8-AHA-CAMP Chemical Properties |
| Boiling point | 745.7±70.0 °C(Predicted) | | density | 1.92±0.1 g/cm3(Predicted) | | storage temp. | −70°C | | solubility | dilute NaOH: soluble | | pka | 0.99±0.60(Predicted) | | form | powder | | color | white | | Water Solubility | water: 50mg/mL, clear, colorless | | InChIKey | WCWLOZYNRVLFOG-SDBHATRESA-N | | SMILES | NCCCCCCNc1nc2c(N)ncnc2n1[C@@H]3O[C@@H]4COP(O)(=O)O[C@H]4[C@H]3O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-AHA-CAMP Usage And Synthesis |
| Uses | Cyclic AMP analog which shows partially selective agonist activity with Type I cAMP-dependent protein kinase isozyme. | | Definition | ChEBI: 8-(6-aminohexylamino)-cAMP is a 3',5'-cyclic purine nucleotide that is 3',5'-cyclic AMP in which the hydrogen at position 2 on the purine fragment is replaced by a 6-aminohexylamino group. It is a 3',5'-cyclic purine nucleotide, an adenyl ribonucleotide, a primary amino compound and a secondary amino compound. It is functionally related to a 3',5'-cyclic AMP. |
| | 8-AHA-CAMP Preparation Products And Raw materials |
|