|
|
| | 4-Bromo-2-hydroxybenzaldehyde Basic information |
| | 4-Bromo-2-hydroxybenzaldehyde Chemical Properties |
| Melting point | 50-54 °C | | Boiling point | 48-52 °C(Press: 0.04 Torr) | | density | 1.737±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | pka | 7.21±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C7H5BrO2/c8-6-2-1-5(4-9)7(10)3-6/h1-4,10H | | InChIKey | HXTWKHXDFATMSP-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(Br)C=C1O | | CAS DataBase Reference | 22532-62-3(CAS DataBase Reference) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 22-50 | | Safety Statements | 60 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 9 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | 4-Bromo-2-hydroxybenzaldehyde Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | 4-Bromo-2-hydroxybenzaldehyde is an important raw material and intermediate used in organic synthesis, Pharmaceuticals, agrochemicals and dyestuffs. | | Uses | 4-Bromosalicylaldehyde is a substituted salicylaldehyde used in the synthesis of BIIB042, a γ-secretase modulator. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 35, p. 734, 1992 DOI: 10.1021/jm00082a014 | | Hazard | 4-Bromo-2-hydroxybenzaldehyde is harmful if swallowed and very toxic to aquatic life, it causes serious eye irritation.
| | storage | 4-Bromo-2-hydroxybenzaldehyde can store long-term in a cool, dry place.
|
| | 4-Bromo-2-hydroxybenzaldehyde Preparation Products And Raw materials |
|