|
|
| | 3-(2',4'-DIFLUOROBENZOYL)PROPIONIC ACID Basic information |
| | 3-(2',4'-DIFLUOROBENZOYL)PROPIONIC ACID Chemical Properties |
| Melting point | 115.0 to 119.0 °C | | Boiling point | 366.7±32.0 °C(Predicted) | | density | 1.363 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.33±0.17(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C10H8F2O3/c11-6-1-2-7(8(12)5-6)9(13)3-4-10(14)15/h1-2,5H,3-4H2,(H,14,15) | | InChIKey | OKYUHFSCTFNDFB-UHFFFAOYSA-N | | SMILES | C(C1C=CC(F)=CC=1F)(=O)CCC(=O)O | | CAS DataBase Reference | 110931-77-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2915601990 |
| | 3-(2',4'-DIFLUOROBENZOYL)PROPIONIC ACID Usage And Synthesis |
| Uses | 3-(2,4-Difluorobenzoyl)propionic Acid is a reagent used in the synthesis of a variety of antimycotics. |
| | 3-(2',4'-DIFLUOROBENZOYL)PROPIONIC ACID Preparation Products And Raw materials |
|