|
|
| | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) Basic information |
| Product Name: | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) | | Synonyms: | 1-Aziridinepropanoicacid,2-methyl-,2-ethyl-2-[[3-(2-methyl-1-aziridinyl)-1-oxopropoxy]methyl]-1,3-propanediylester;2-ethyl-2-((3-(2-methyl-1-aziridinyl)-1-1-aziridinepropanoicaci;2-methyl-1-aziridinepropanoicaci2-ethyl-2-[[3-(2-methyl-1-aziridinyl)-1-o;c-80343;crosslinkercx100;cx100;POLY X100;2-ethyl-2-[[3-(2-Methyl-1-aziridinyl)-1-oxopropoxy]Methyl]-1,3-propanediyl]ester | | CAS: | 64265-57-2 | | MF: | C24H41N3O6 | | MW: | 467.6 | | EINECS: | 264-763-3 | | Product Categories: | Tertiary Amines;Monomers;Amine Monomers | | Mol File: | 64265-57-2.mol |  |
| | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) Chemical Properties |
| Melting point | -30℃ | | Boiling point | 532.1±50.0 °C(Predicted) | | density | 1.1 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.477(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 7.31±0.40(Predicted) | | color | Colourless | | InChI | InChI=1S/C24H41N3O6/c1-5-24(15-31-21(28)6-9-25-12-18(25)2,16-32-22(29)7-10-26-13-19(26)3)17-33-23(30)8-11-27-14-20(27)4/h18-20H,5-17H2,1-4H3 | | InChIKey | YKEGOEUSKXVSPN-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCN1CC1C)C(CC)(COC(=O)CCN1CC1C)COC(=O)CCN1CC1C | | EPA Substance Registry System | Trimethylolpropane tris[3-(2-methyl-1-aziridinyl)propionate] (64265-57-2) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | CM8544125 | | TSCA | TSCA listed |
| | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) Usage And Synthesis |
| Chemical Properties | Colorless to light yellow transparent liquid | | Uses | Trimethylolpropane Tris(2-methyl-1-aziridinepropionate) is one of the triaziridnyl compounds added as a latent curing agent for single pack self-curable polyurethane (PU) systems. | | Application | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) can be widely used in ink, coating, PSA, adhesive to improve the water, chemical, alcohol, detergent resistance and cohesive strength. It is also environmental-friendly, as the finished products is non-toxic and non-smell without any chemical hazards such as methanol after cross linking. | | Toxics Screening Level | The Initial Threshold Screening Level (ITSL) is being established at 10 μg/m3 with annual averaging. |
| | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) Preparation Products And Raw materials |
|