| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(4-Chlorophenyl)-1,3-cyclohexanedione Basic information |
| | 5-(4-Chlorophenyl)-1,3-cyclohexanedione Chemical Properties |
| Melting point | 185-189 °C(lit.) | | Boiling point | 384.217±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.268±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 4.840±0.20(predicted) | | InChI | 1S/C12H11ClO2/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2 | | InChIKey | MAFYKXZPGMHTIA-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C2CC(=O)CC(=O)C2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2914790090 | | Storage Class | 13 - Non Combustible Solids |
| | 5-(4-Chlorophenyl)-1,3-cyclohexanedione Usage And Synthesis |
| Uses | 5-(4-Chlorophenyl)-1,3-cyclohexanedione may be used in the synthesis of 3-(5-(4-chlorophenyl)-3-oxocyclohex-1-enylamino)thiophene-2-carbonitrile. |
| | 5-(4-Chlorophenyl)-1,3-cyclohexanedione Preparation Products And Raw materials |
|