|
|
| | 1-Boc-2,6-dimethyl-piperazine Basic information |
| Product Name: | 1-Boc-2,6-dimethyl-piperazine | | Synonyms: | tert-butyl 2,6-diMethylpiperazine-1-carboxylate;2,6-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester;1-Boc-2,6-diMethylpiperaz...;1-Piperazinecarboxylic acid, 2,6-diMethyl-, 1,1-diMethylethyl ester;2,6-Dimethyl-1-piperazinecarboxylic acid tert-butyl ester;1,1-Dimethylethyl 2,6-dimethyl-1-piperazinecarboxylate;tert-Butyl 2,6-dimethyl-1-piperazinecarboxylate;1-Boc-2,6-dimethyl-piperazine | | CAS: | 688363-66-8 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 688363-66-8.mol |  |
| | 1-Boc-2,6-dimethyl-piperazine Chemical Properties |
| Boiling point | 279.7±15.0 °C(Predicted) | | density | 0.970±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 8.53±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H22N2O2/c1-8-6-12-7-9(2)13(8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3 | | InChIKey | RBOGBIZGALIITO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C(C)CNCC1C |
| | 1-Boc-2,6-dimethyl-piperazine Usage And Synthesis |
| | 1-Boc-2,6-dimethyl-piperazine Preparation Products And Raw materials |
|